About 4-[(7-amino-5-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-2-[(4-fluorophenyl)methyl]phenol
4-[(7-amino-5-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-2-[(4-fluorophenyl)methyl]phenol (PubChem CID 23031242) has the molecular formula C23H22FNO2
and a molecular weight of 363.43 g/mol. Its IUPAC name is 4-[(7-amino-5-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-2-[(4-fluorophenyl)methyl]phenol.
Molecular Properties
| Compound Name | 4-[(7-amino-5-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-2-[(4-fluorophenyl)methyl]phenol |
| PubChem CID | 23031242 |
| Molecular Formula | C23H22FNO2 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 4-[(7-amino-5-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-2-[(4-fluorophenyl)methyl]phenol |
| SMILES | Cc1cc(N)c2c(c1Oc1ccc(O)c(Cc3ccc(F)cc3)c1)CCC2 |
| InChI | InChI=1S/C23H22FNO2/c1-14-11-21(25)19-3-2-4-20(19)23(14)27-18-9-10-22(26)16(13-18)12-15-5-7-17(24)8-6-15/h5-11,13,26H,2-4,12,25H2,1H3 |
| InChIKey | YYJADNUSOCVLKD-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[(7-amino-5-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-2-[(4-fluorophenyl)methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(7-amino-5-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-2-[(4-fluorophenyl)methyl]phenol?
The IUPAC name of 4-[(7-amino-5-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-2-[(4-fluorophenyl)methyl]phenol (CID 23031242) is 4-[(7-amino-5-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-2-[(4-fluorophenyl)methyl]phenol.
What is the SMILES notation for 4-[(7-amino-5-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-2-[(4-fluorophenyl)methyl]phenol?
The canonical SMILES for 4-[(7-amino-5-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-2-[(4-fluorophenyl)methyl]phenol is Cc1cc(N)c2c(c1Oc1ccc(O)c(Cc3ccc(F)cc3)c1)CCC2.
What is the InChIKey of 4-[(7-amino-5-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-2-[(4-fluorophenyl)methyl]phenol?
The InChIKey is YYJADNUSOCVLKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22FNO2/c1-14-11-21(25)19-3-2-4-20(19)23(14)27-18-9-10-22(26)16(13-18)12-15-5-7-17(24)8-6-15/h5-11,13,26H,2-4,12,25H2,1H3.
What are the key properties of 4-[(7-amino-5-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-2-[(4-fluorophenyl)methyl]phenol?
4-[(7-amino-5-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-2-[(4-fluorophenyl)methyl]phenol has a molecular weight of 363.43 g/mol, XLogP of 5.29, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(7-amino-5-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-2-[(4-fluorophenyl)methyl]phenol is sourced from PubChem (CID 23031242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).