C20H24Cl2NO4PS — CID 23031330
[2-amino-4-[5-[5-(3,5-dichlorophenyl)pent-1-ynyl]thiophen-2-yl]-2-methylbutyl] dihydrogen phosphate (PubChem CID 23031330) has the molecular formula C20H24Cl2NO4PS and a molecular weight of 476.36 g/mol. Its IUPAC name is [2-amino-4-[5-[5-(3,5-dichlorophenyl)pent-1-ynyl]thiophen-2-yl]-2-methylbutyl] dihydrogen phosphate.
| Compound Name | [2-amino-4-[5-[5-(3,5-dichlorophenyl)pent-1-ynyl]thiophen-2-yl]-2-methylbutyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 23031330 |
| Molecular Formula | C20H24Cl2NO4PS |
| Molecular Weight | 476.36 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | [2-amino-4-[5-[5-(3,5-dichlorophenyl)pent-1-ynyl]thiophen-2-yl]-2-methylbutyl] dihydrogen phosphate |
| SMILES | CC(N)(CCc1ccc(C#CCCCc2cc(Cl)cc(Cl)c2)s1)COP(=O)(O)O |
| InChI | InChI=1S/C20H24Cl2NO4PS/c1-20(23,14-27-28(24,25)26)10-9-19-8-7-18(29-19)6-4-2-3-5-15-11-16(21)13-17(22)12-15/h7-8,11-13H,2-3,5,9-10,14,23H2,1H3,(H2,24,25,26) |
| InChIKey | HMPZEQMSXJFJCY-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.36 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|