About 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate
2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate (PubChem CID 23031674) has the molecular formula C8H7O4-
and a molecular weight of 167.14 g/mol. Its IUPAC name is 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate.
Molecular Properties
| Compound Name | 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate |
| PubChem CID | 23031674 |
| Molecular Formula | C8H7O4- |
| Molecular Weight | 167.14 g/mol |
| Exact Mass | 167.03 |
| IUPAC Name | 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate |
| SMILES | O=C1C=CC(O)(CC(=O)[O-])C=C1 |
| InChI | InChI=1S/C8H8O4/c9-6-1-3-8(12,4-2-6)5-7(10)11/h1-4,12H,5H2,(H,10,11)/p-1 |
| InChIKey | RFJUCKOEXRTZPN-UHFFFAOYSA-M |
| XLogP | -1.45 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.14 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate?
The IUPAC name of 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate (CID 23031674) is 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate.
What is the SMILES notation for 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate?
The canonical SMILES for 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate is O=C1C=CC(O)(CC(=O)[O-])C=C1.
What is the InChIKey of 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate?
The InChIKey is RFJUCKOEXRTZPN-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H8O4/c9-6-1-3-8(12,4-2-6)5-7(10)11/h1-4,12H,5H2,(H,10,11)/p-1.
What are the key properties of 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate?
2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate has a molecular weight of 167.14 g/mol, XLogP of -1.45, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate is sourced from PubChem (CID 23031674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).