About 2-(2,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate
2-(2,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate (PubChem CID 23031676) has the molecular formula C8H5Cl2O4-
and a molecular weight of 236.03 g/mol. Its IUPAC name is 2-(2,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate.
Molecular Properties
| Compound Name | 2-(2,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate |
| PubChem CID | 23031676 |
| Molecular Formula | C8H5Cl2O4- |
| Molecular Weight | 236.03 g/mol |
| Exact Mass | 234.96 |
| IUPAC Name | 2-(2,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate |
| SMILES | O=C([O-])CC1(O)C=C(Cl)C(=O)C=C1Cl |
| InChI | InChI=1S/C8H6Cl2O4/c9-4-2-8(14,3-7(12)13)6(10)1-5(4)11/h1-2,14H,3H2,(H,12,13)/p-1 |
| InChIKey | LJQVRUDOWYAGKZ-UHFFFAOYSA-M |
| XLogP | -0.31 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.03 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate?
The IUPAC name of 2-(2,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate (CID 23031676) is 2-(2,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate.
What is the SMILES notation for 2-(2,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate?
The canonical SMILES for 2-(2,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate is O=C([O-])CC1(O)C=C(Cl)C(=O)C=C1Cl.
What is the InChIKey of 2-(2,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate?
The InChIKey is LJQVRUDOWYAGKZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H6Cl2O4/c9-4-2-8(14,3-7(12)13)6(10)1-5(4)11/h1-2,14H,3H2,(H,12,13)/p-1.
What are the key properties of 2-(2,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate?
2-(2,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate has a molecular weight of 236.03 g/mol, XLogP of -0.31, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate is sourced from PubChem (CID 23031676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).