C8H3Cl4O4- — CID 23031683
2-(2,3,5,6-tetrachloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate (PubChem CID 23031683) has the molecular formula C8H3Cl4O4- and a molecular weight of 304.92 g/mol. Its IUPAC name is 2-(2,3,5,6-tetrachloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate.
| Compound Name | 2-(2,3,5,6-tetrachloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate |
|---|---|
| PubChem CID | 23031683 |
| Molecular Formula | C8H3Cl4O4- |
| Molecular Weight | 304.92 g/mol |
| Exact Mass | 302.88 |
| IUPAC Name | 2-(2,3,5,6-tetrachloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate |
| SMILES | O=C([O-])CC1(O)C(Cl)=C(Cl)C(=O)C(Cl)=C1Cl |
| InChI | InChI=1S/C8H4Cl4O4/c9-3-5(15)4(10)7(12)8(16,6(3)11)1-2(13)14/h16H,1H2,(H,13,14)/p-1 |
| InChIKey | MHYSLYZYYXWAGI-UHFFFAOYSA-M |
| XLogP | 0.82 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.92 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|