C8H9ClN2O — CID 23032566
4-chloro-5,6,7,8-tetrahydro-2H-phthalazin-1-one (PubChem CID 23032566) has the molecular formula C8H9ClN2O and a molecular weight of 184.63 g/mol. Its IUPAC name is 4-chloro-5,6,7,8-tetrahydro-2H-phthalazin-1-one.
| Compound Name | 4-chloro-5,6,7,8-tetrahydro-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 23032566 |
| Molecular Formula | C8H9ClN2O |
| Molecular Weight | 184.63 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 4-chloro-5,6,7,8-tetrahydro-2H-phthalazin-1-one |
| SMILES | O=c1[nH]nc(Cl)c2c1CCCC2 |
| InChI | InChI=1S/C8H9ClN2O/c9-7-5-3-1-2-4-6(5)8(12)11-10-7/h1-4H2,(H,11,12) |
| InChIKey | FELMGSLVMGWMRN-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.63 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |