About triethylsulfanium;trimethylsulfanium;dichloride
triethylsulfanium;trimethylsulfanium;dichloride (PubChem CID 23032990) has the molecular formula C9H24Cl2S2
and a molecular weight of 267.33 g/mol. Its IUPAC name is triethylsulfanium;trimethylsulfanium;dichloride.
Molecular Properties
| Compound Name | triethylsulfanium;trimethylsulfanium;dichloride |
| PubChem CID | 23032990 |
| Molecular Formula | C9H24Cl2S2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | triethylsulfanium;trimethylsulfanium;dichloride |
| SMILES | CC[S+](CC)CC.C[S+](C)C.[Cl-].[Cl-] |
| InChI | InChI=1S/C6H15S.C3H9S.2ClH/c1-4-7(5-2)6-3;1-4(2)3;;/h4-6H2,1-3H3;1-3H3;2*1H/q2*+1;;/p-2 |
| InChIKey | KHLCEAFRSQMBCK-UHFFFAOYSA-L |
| XLogP | -3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze triethylsulfanium;trimethylsulfanium;dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethylsulfanium;trimethylsulfanium;dichloride?
The IUPAC name of triethylsulfanium;trimethylsulfanium;dichloride (CID 23032990) is triethylsulfanium;trimethylsulfanium;dichloride.
What is the SMILES notation for triethylsulfanium;trimethylsulfanium;dichloride?
The canonical SMILES for triethylsulfanium;trimethylsulfanium;dichloride is CC[S+](CC)CC.C[S+](C)C.[Cl-].[Cl-].
What is the InChIKey of triethylsulfanium;trimethylsulfanium;dichloride?
The InChIKey is KHLCEAFRSQMBCK-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H15S.C3H9S.2ClH/c1-4-7(5-2)6-3;1-4(2)3;;/h4-6H2,1-3H3;1-3H3;2*1H/q2*+1;;/p-2.
What are the key properties of triethylsulfanium;trimethylsulfanium;dichloride?
triethylsulfanium;trimethylsulfanium;dichloride has a molecular weight of 267.33 g/mol, XLogP of -3.83, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triethylsulfanium;trimethylsulfanium;dichloride is sourced from PubChem (CID 23032990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).