C10H13NO5S — CID 23034114
[4-(2-amino-1-methoxy-2-oxoethyl)phenyl] methanesulfonate (PubChem CID 23034114) has the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. Its IUPAC name is [4-(2-amino-1-methoxy-2-oxoethyl)phenyl] methanesulfonate.
| Compound Name | [4-(2-amino-1-methoxy-2-oxoethyl)phenyl] methanesulfonate |
|---|---|
| PubChem CID | 23034114 |
| Molecular Formula | C10H13NO5S |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | [4-(2-amino-1-methoxy-2-oxoethyl)phenyl] methanesulfonate |
| SMILES | COC(C(N)=O)c1ccc(OS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C10H13NO5S/c1-15-9(10(11)12)7-3-5-8(6-4-7)16-17(2,13)14/h3-6,9H,1-2H3,(H2,11,12) |
| InChIKey | JHKUXICJMBQYMN-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|