C16H15Cl2NO — CID 2303417
N-[(1S)-2,2-dichloro-1-phenylethyl]-4-methylbenzamide (PubChem CID 2303417) has the molecular formula C16H15Cl2NO and a molecular weight of 308.21 g/mol. Its IUPAC name is N-[(1S)-2,2-dichloro-1-phenylethyl]-4-methylbenzamide.
| Compound Name | N-[(1S)-2,2-dichloro-1-phenylethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 2303417 |
| Molecular Formula | C16H15Cl2NO |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | N-[(1S)-2,2-dichloro-1-phenylethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N[C@@H](c2ccccc2)C(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H15Cl2NO/c1-11-7-9-13(10-8-11)16(20)19-14(15(17)18)12-5-3-2-4-6-12/h2-10,14-15H,1H3,(H,19,20)/t14-/m0/s1 |
| InChIKey | GBEXSXGFCAZXRG-AWEZNQCLSA-N |
| XLogP | 4.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|