About [4-(1-cyanoethyl)phenyl] methanesulfonate
[4-(1-cyanoethyl)phenyl] methanesulfonate (PubChem CID 23034574) has the molecular formula C10H11NO3S
and a molecular weight of 225.27 g/mol. Its IUPAC name is [4-(1-cyanoethyl)phenyl] methanesulfonate.
Molecular Properties
| Compound Name | [4-(1-cyanoethyl)phenyl] methanesulfonate |
| PubChem CID | 23034574 |
| Molecular Formula | C10H11NO3S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | [4-(1-cyanoethyl)phenyl] methanesulfonate |
| SMILES | CC(C#N)c1ccc(OS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C10H11NO3S/c1-8(7-11)9-3-5-10(6-4-9)14-15(2,12)13/h3-6,8H,1-2H3 |
| InChIKey | KZBWWFCMHRDTQX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(1-cyanoethyl)phenyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1-cyanoethyl)phenyl] methanesulfonate?
The IUPAC name of [4-(1-cyanoethyl)phenyl] methanesulfonate (CID 23034574) is [4-(1-cyanoethyl)phenyl] methanesulfonate.
What is the SMILES notation for [4-(1-cyanoethyl)phenyl] methanesulfonate?
The canonical SMILES for [4-(1-cyanoethyl)phenyl] methanesulfonate is CC(C#N)c1ccc(OS(C)(=O)=O)cc1.
What is the InChIKey of [4-(1-cyanoethyl)phenyl] methanesulfonate?
The InChIKey is KZBWWFCMHRDTQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO3S/c1-8(7-11)9-3-5-10(6-4-9)14-15(2,12)13/h3-6,8H,1-2H3.
What are the key properties of [4-(1-cyanoethyl)phenyl] methanesulfonate?
[4-(1-cyanoethyl)phenyl] methanesulfonate has a molecular weight of 225.27 g/mol, XLogP of 1.65, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1-cyanoethyl)phenyl] methanesulfonate is sourced from PubChem (CID 23034574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).