C29H17F7O4S — CID 23034940
2,2,3,3,4,4,4-heptafluorobutanoate;(9-oxoxanthen-2-yl)-diphenylsulfanium (PubChem CID 23034940) has the molecular formula C29H17F7O4S and a molecular weight of 594.50 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluorobutanoate;(9-oxoxanthen-2-yl)-diphenylsulfanium.
| Compound Name | 2,2,3,3,4,4,4-heptafluorobutanoate;(9-oxoxanthen-2-yl)-diphenylsulfanium |
|---|---|
| PubChem CID | 23034940 |
| Molecular Formula | C29H17F7O4S |
| Molecular Weight | 594.50 g/mol |
| Exact Mass | 594.07 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutanoate;(9-oxoxanthen-2-yl)-diphenylsulfanium |
| SMILES | O=C([O-])C(F)(F)C(F)(F)C(F)(F)F.O=c1c2ccccc2oc2ccc([S+](c3ccccc3)c3ccccc3)cc12 |
| InChI | InChI=1S/C25H17O2S.C4HF7O2/c26-25-21-13-7-8-14-23(21)27-24-16-15-20(17-22(24)25)28(18-9-3-1-4-10-18)19-11-5-2-6-12-19;5-2(6,1(12)13)3(7,8)4(9,10)11/h1-17H;(H,12,13)/q+1;/p-1 |
| InChIKey | COORAGWBUBJHML-UHFFFAOYSA-M |
| XLogP | 6.61 |
| TPSA | 70.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.50 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|