About benzene-1,4-diol;methyl 2-methylprop-2-enoate
benzene-1,4-diol;methyl 2-methylprop-2-enoate (PubChem CID 23036045) has the molecular formula C11H14O4
and a molecular weight of 210.23 g/mol. Its IUPAC name is benzene-1,4-diol;methyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | benzene-1,4-diol;methyl 2-methylprop-2-enoate |
| PubChem CID | 23036045 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | benzene-1,4-diol;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C6H6O2.C5H8O2/c7-5-1-2-6(8)4-3-5;1-4(2)5(6)7-3/h1-4,7-8H;1H2,2-3H3 |
| InChIKey | DXORWOXMIMWULJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,4-diol;methyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,4-diol;methyl 2-methylprop-2-enoate?
The IUPAC name of benzene-1,4-diol;methyl 2-methylprop-2-enoate (CID 23036045) is benzene-1,4-diol;methyl 2-methylprop-2-enoate.
What is the SMILES notation for benzene-1,4-diol;methyl 2-methylprop-2-enoate?
The canonical SMILES for benzene-1,4-diol;methyl 2-methylprop-2-enoate is C=C(C)C(=O)OC.Oc1ccc(O)cc1.
What is the InChIKey of benzene-1,4-diol;methyl 2-methylprop-2-enoate?
The InChIKey is DXORWOXMIMWULJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.C5H8O2/c7-5-1-2-6(8)4-3-5;1-4(2)5(6)7-3/h1-4,7-8H;1H2,2-3H3.
What are the key properties of benzene-1,4-diol;methyl 2-methylprop-2-enoate?
benzene-1,4-diol;methyl 2-methylprop-2-enoate has a molecular weight of 210.23 g/mol, XLogP of 1.83, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,4-diol;methyl 2-methylprop-2-enoate is sourced from PubChem (CID 23036045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).