C19H15F2NO — CID 23036417
1,1-bis(4-fluorophenyl)-2-pyridin-3-ylethanol (PubChem CID 23036417) has the molecular formula C19H15F2NO and a molecular weight of 311.33 g/mol. Its IUPAC name is 1,1-bis(4-fluorophenyl)-2-pyridin-3-ylethanol.
| Compound Name | 1,1-bis(4-fluorophenyl)-2-pyridin-3-ylethanol |
|---|---|
| PubChem CID | 23036417 |
| Molecular Formula | C19H15F2NO |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 1,1-bis(4-fluorophenyl)-2-pyridin-3-ylethanol |
| SMILES | OC(Cc1cccnc1)(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H15F2NO/c20-17-7-3-15(4-8-17)19(23,12-14-2-1-11-22-13-14)16-5-9-18(21)10-6-16/h1-11,13,23H,12H2 |
| InChIKey | DLUDHJGMOAQXIC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |