C11H16N4O4 — CID 23036702
1-[2-(2,3-dioxopiperazin-1-yl)propyl]piperazine-2,3-dione (PubChem CID 23036702) has the molecular formula C11H16N4O4 and a molecular weight of 268.27 g/mol. Its IUPAC name is 1-[2-(2,3-dioxopiperazin-1-yl)propyl]piperazine-2,3-dione.
| Compound Name | 1-[2-(2,3-dioxopiperazin-1-yl)propyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 23036702 |
| Molecular Formula | C11H16N4O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 1-[2-(2,3-dioxopiperazin-1-yl)propyl]piperazine-2,3-dione |
| SMILES | CC(CN1CCNC(=O)C1=O)N1CCNC(=O)C1=O |
| InChI | InChI=1S/C11H16N4O4/c1-7(15-5-3-13-9(17)11(15)19)6-14-4-2-12-8(16)10(14)18/h7H,2-6H2,1H3,(H,12,16)(H,13,17) |
| InChIKey | XVFZCQJWWCSBCJ-UHFFFAOYSA-N |
| XLogP | -2.71 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|