C5H4Cl2F6 — CID 23036937
1,1-dichloro-2,2,3,3,4,4-hexafluoropentane (PubChem CID 23036937) has the molecular formula C5H4Cl2F6 and a molecular weight of 248.98 g/mol. Its IUPAC name is 1,1-dichloro-2,2,3,3,4,4-hexafluoropentane.
| Compound Name | 1,1-dichloro-2,2,3,3,4,4-hexafluoropentane |
|---|---|
| PubChem CID | 23036937 |
| Molecular Formula | C5H4Cl2F6 |
| Molecular Weight | 248.98 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | 1,1-dichloro-2,2,3,3,4,4-hexafluoropentane |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)C(Cl)Cl |
| InChI | InChI=1S/C5H4Cl2F6/c1-3(8,9)5(12,13)4(10,11)2(6)7/h2H,1H3 |
| InChIKey | IZTIBWWBMCZHKP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.98 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|