About diiodopalladium;bis(tris(4-methylphenyl)phosphane)
diiodopalladium;bis(tris(4-methylphenyl)phosphane) (PubChem CID 23037656) has the molecular formula C42H42I2P2Pd
and a molecular weight of 968.97 g/mol. Its IUPAC name is diiodopalladium;bis(tris(4-methylphenyl)phosphane).
Molecular Properties
| Compound Name | diiodopalladium;bis(tris(4-methylphenyl)phosphane) |
| PubChem CID | 23037656 |
| Molecular Formula | C42H42I2P2Pd |
| Molecular Weight | 968.97 g/mol |
| Exact Mass | 967.99 |
| IUPAC Name | diiodopalladium;bis(tris(4-methylphenyl)phosphane) |
| SMILES | Cc1ccc(P(c2ccc(C)cc2)c2ccc(C)cc2)cc1.Cc1ccc(P(c2ccc(C)cc2)c2ccc(C)cc2)cc1.I[Pd]I |
| InChI | InChI=1S/2C21H21P.2HI.Pd/c2*1-16-4-10-19(11-5-16)22(20-12-6-17(2)7-13-20)21-14-8-18(3)9-15-21;;;/h2*4-15H,1-3H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | XIHHUHDHWOJEIA-UHFFFAOYSA-L |
| XLogP | 10.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 968.97 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diiodopalladium;bis(tris(4-methylphenyl)phosphane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diiodopalladium;bis(tris(4-methylphenyl)phosphane)?
The IUPAC name of diiodopalladium;bis(tris(4-methylphenyl)phosphane) (CID 23037656) is diiodopalladium;bis(tris(4-methylphenyl)phosphane).
What is the SMILES notation for diiodopalladium;bis(tris(4-methylphenyl)phosphane)?
The canonical SMILES for diiodopalladium;bis(tris(4-methylphenyl)phosphane) is Cc1ccc(P(c2ccc(C)cc2)c2ccc(C)cc2)cc1.Cc1ccc(P(c2ccc(C)cc2)c2ccc(C)cc2)cc1.I[Pd]I.
What is the InChIKey of diiodopalladium;bis(tris(4-methylphenyl)phosphane)?
The InChIKey is XIHHUHDHWOJEIA-UHFFFAOYSA-L. The full InChI is InChI=1S/2C21H21P.2HI.Pd/c2*1-16-4-10-19(11-5-16)22(20-12-6-17(2)7-13-20)21-14-8-18(3)9-15-21;;;/h2*4-15H,1-3H3;2*1H;/q;;;;+2/p-2.
What are the key properties of diiodopalladium;bis(tris(4-methylphenyl)phosphane)?
diiodopalladium;bis(tris(4-methylphenyl)phosphane) has a molecular weight of 968.97 g/mol, XLogP of 10.51, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diiodopalladium;bis(tris(4-methylphenyl)phosphane) is sourced from PubChem (CID 23037656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).