C12H16N2O6 — CID 23038057
1,2-dioxa-3,4-diazacyclohexadec-3-ene-5,6,7,8-tetrone (PubChem CID 23038057) has the molecular formula C12H16N2O6 and a molecular weight of 284.27 g/mol. Its IUPAC name is 1,2-dioxa-3,4-diazacyclohexadec-3-ene-5,6,7,8-tetrone.
| Compound Name | 1,2-dioxa-3,4-diazacyclohexadec-3-ene-5,6,7,8-tetrone |
|---|---|
| PubChem CID | 23038057 |
| Molecular Formula | C12H16N2O6 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 1,2-dioxa-3,4-diazacyclohexadec-3-ene-5,6,7,8-tetrone |
| SMILES | O=C1CCCCCCCCOO/N=N/C(=O)C(=O)C1=O |
| InChI | InChI=1S/C12H16N2O6/c15-9-7-5-3-1-2-4-6-8-19-20-14-13-12(18)11(17)10(9)16/h1-8H2/b14-13+ |
| InChIKey | XFAVOMRWJDQVBM-BUHFOSPRSA-N |
| XLogP | 1.28 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|