C8H11NOS — CID 23038095
7-methoxy-4,5,6,7-tetrahydro-1,3-benzothiazole (PubChem CID 23038095) has the molecular formula C8H11NOS and a molecular weight of 169.25 g/mol. Its IUPAC name is 7-methoxy-4,5,6,7-tetrahydro-1,3-benzothiazole.
| Compound Name | 7-methoxy-4,5,6,7-tetrahydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 23038095 |
| Molecular Formula | C8H11NOS |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 7-methoxy-4,5,6,7-tetrahydro-1,3-benzothiazole |
| SMILES | COC1CCCc2ncsc21 |
| InChI | InChI=1S/C8H11NOS/c1-10-7-4-2-3-6-8(7)11-5-9-6/h5,7H,2-4H2,1H3 |
| InChIKey | LVRREYDRUBENPI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |