C20H17ClO5 — CID 23038234
bicyclo[2.2.0]hexa-1,3,5-triene;(7-chloro-4-hydroxy-2,3-dimethoxynaphthalen-1-yl) acetate (PubChem CID 23038234) has the molecular formula C20H17ClO5 and a molecular weight of 372.80 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-triene;(7-chloro-4-hydroxy-2,3-dimethoxynaphthalen-1-yl) acetate.
| Compound Name | bicyclo[2.2.0]hexa-1,3,5-triene;(7-chloro-4-hydroxy-2,3-dimethoxynaphthalen-1-yl) acetate |
|---|---|
| PubChem CID | 23038234 |
| Molecular Formula | C20H17ClO5 |
| Molecular Weight | 372.80 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,3,5-triene;(7-chloro-4-hydroxy-2,3-dimethoxynaphthalen-1-yl) acetate |
| SMILES | COc1c(OC)c(OC(C)=O)c2cc(Cl)ccc2c1O.c1cc2ccc1-2 |
| InChI | InChI=1S/C14H13ClO5.C6H4/c1-7(16)20-12-10-6-8(15)4-5-9(10)11(17)13(18-2)14(12)19-3;1-2-6-4-3-5(1)6/h4-6,17H,1-3H3;1-4H |
| InChIKey | DGPZZPUVYYHGQD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.80 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|