About 7-chloro-2,3-bis(4-ethylphenoxy)-4-phenylmethoxynaphthalen-1-ol
7-chloro-2,3-bis(4-ethylphenoxy)-4-phenylmethoxynaphthalen-1-ol (PubChem CID 23038551) has the molecular formula C33H29ClO4
and a molecular weight of 525.04 g/mol. Its IUPAC name is 7-chloro-2,3-bis(4-ethylphenoxy)-4-phenylmethoxynaphthalen-1-ol.
Molecular Properties
| Compound Name | 7-chloro-2,3-bis(4-ethylphenoxy)-4-phenylmethoxynaphthalen-1-ol |
| PubChem CID | 23038551 |
| Molecular Formula | C33H29ClO4 |
| Molecular Weight | 525.04 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | 7-chloro-2,3-bis(4-ethylphenoxy)-4-phenylmethoxynaphthalen-1-ol |
| SMILES | CCc1ccc(Oc2c(Oc3ccc(CC)cc3)c(OCc3ccccc3)c3ccc(Cl)cc3c2O)cc1 |
| InChI | InChI=1S/C33H29ClO4/c1-3-22-10-15-26(16-11-22)37-32-30(35)29-20-25(34)14-19-28(29)31(36-21-24-8-6-5-7-9-24)33(32)38-27-17-12-23(4-2)13-18-27/h5-20,35H,3-4,21H2,1-2H3 |
| InChIKey | ASYIMARAWRUQIE-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 525.04 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-chloro-2,3-bis(4-ethylphenoxy)-4-phenylmethoxynaphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2,3-bis(4-ethylphenoxy)-4-phenylmethoxynaphthalen-1-ol?
The IUPAC name of 7-chloro-2,3-bis(4-ethylphenoxy)-4-phenylmethoxynaphthalen-1-ol (CID 23038551) is 7-chloro-2,3-bis(4-ethylphenoxy)-4-phenylmethoxynaphthalen-1-ol.
What is the SMILES notation for 7-chloro-2,3-bis(4-ethylphenoxy)-4-phenylmethoxynaphthalen-1-ol?
The canonical SMILES for 7-chloro-2,3-bis(4-ethylphenoxy)-4-phenylmethoxynaphthalen-1-ol is CCc1ccc(Oc2c(Oc3ccc(CC)cc3)c(OCc3ccccc3)c3ccc(Cl)cc3c2O)cc1.
What is the InChIKey of 7-chloro-2,3-bis(4-ethylphenoxy)-4-phenylmethoxynaphthalen-1-ol?
The InChIKey is ASYIMARAWRUQIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H29ClO4/c1-3-22-10-15-26(16-11-22)37-32-30(35)29-20-25(34)14-19-28(29)31(36-21-24-8-6-5-7-9-24)33(32)38-27-17-12-23(4-2)13-18-27/h5-20,35H,3-4,21H2,1-2H3.
What are the key properties of 7-chloro-2,3-bis(4-ethylphenoxy)-4-phenylmethoxynaphthalen-1-ol?
7-chloro-2,3-bis(4-ethylphenoxy)-4-phenylmethoxynaphthalen-1-ol has a molecular weight of 525.04 g/mol, XLogP of 9.49, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2,3-bis(4-ethylphenoxy)-4-phenylmethoxynaphthalen-1-ol is sourced from PubChem (CID 23038551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).