C24H17ClO4 — CID 23038640
6-chloro-2,3-bis(3-methylphenoxy)naphthalene-1,4-dione (PubChem CID 23038640) has the molecular formula C24H17ClO4 and a molecular weight of 404.85 g/mol. Its IUPAC name is 6-chloro-2,3-bis(3-methylphenoxy)naphthalene-1,4-dione.
| Compound Name | 6-chloro-2,3-bis(3-methylphenoxy)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 23038640 |
| Molecular Formula | C24H17ClO4 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 6-chloro-2,3-bis(3-methylphenoxy)naphthalene-1,4-dione |
| SMILES | Cc1cccc(OC2=C(Oc3cccc(C)c3)C(=O)c3cc(Cl)ccc3C2=O)c1 |
| InChI | InChI=1S/C24H17ClO4/c1-14-5-3-7-17(11-14)28-23-21(26)19-10-9-16(25)13-20(19)22(27)24(23)29-18-8-4-6-15(2)12-18/h3-13H,1-2H3 |
| InChIKey | RKQNBLHDKYPNTA-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|