About 2,2-difluoro-1,1-diphenylethanol
2,2-difluoro-1,1-diphenylethanol (PubChem CID 2303871) has the molecular formula C14H12F2O
and a molecular weight of 234.25 g/mol. Its IUPAC name is 2,2-difluoro-1,1-diphenylethanol.
Molecular Properties
| Compound Name | 2,2-difluoro-1,1-diphenylethanol |
| PubChem CID | 2303871 |
| Molecular Formula | C14H12F2O |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 2,2-difluoro-1,1-diphenylethanol |
| SMILES | OC(c1ccccc1)(c1ccccc1)C(F)F |
| InChI | InChI=1S/C14H12F2O/c15-13(16)14(17,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13,17H |
| InChIKey | VXEVTIROYPQINO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-difluoro-1,1-diphenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-1,1-diphenylethanol?
The IUPAC name of 2,2-difluoro-1,1-diphenylethanol (CID 2303871) is 2,2-difluoro-1,1-diphenylethanol.
What is the SMILES notation for 2,2-difluoro-1,1-diphenylethanol?
The canonical SMILES for 2,2-difluoro-1,1-diphenylethanol is OC(c1ccccc1)(c1ccccc1)C(F)F.
What is the InChIKey of 2,2-difluoro-1,1-diphenylethanol?
The InChIKey is VXEVTIROYPQINO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F2O/c15-13(16)14(17,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13,17H.
What are the key properties of 2,2-difluoro-1,1-diphenylethanol?
2,2-difluoro-1,1-diphenylethanol has a molecular weight of 234.25 g/mol, XLogP of 3.19, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-1,1-diphenylethanol is sourced from PubChem (CID 2303871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).