About 6-amino-2,3-bis(4-methylpentoxy)naphthalene-1,4-dione
6-amino-2,3-bis(4-methylpentoxy)naphthalene-1,4-dione (PubChem CID 23038829) has the molecular formula C22H31NO4
and a molecular weight of 373.49 g/mol. Its IUPAC name is 6-amino-2,3-bis(4-methylpentoxy)naphthalene-1,4-dione.
Molecular Properties
| Compound Name | 6-amino-2,3-bis(4-methylpentoxy)naphthalene-1,4-dione |
| PubChem CID | 23038829 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | 6-amino-2,3-bis(4-methylpentoxy)naphthalene-1,4-dione |
| SMILES | CC(C)CCCOC1=C(OCCCC(C)C)C(=O)c2cc(N)ccc2C1=O |
| InChI | InChI=1S/C22H31NO4/c1-14(2)7-5-11-26-21-19(24)17-10-9-16(23)13-18(17)20(25)22(21)27-12-6-8-15(3)4/h9-10,13-15H,5-8,11-12,23H2,1-4H3 |
| InChIKey | VLDZRMINFDXECZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-2,3-bis(4-methylpentoxy)naphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-2,3-bis(4-methylpentoxy)naphthalene-1,4-dione?
The IUPAC name of 6-amino-2,3-bis(4-methylpentoxy)naphthalene-1,4-dione (CID 23038829) is 6-amino-2,3-bis(4-methylpentoxy)naphthalene-1,4-dione.
What is the SMILES notation for 6-amino-2,3-bis(4-methylpentoxy)naphthalene-1,4-dione?
The canonical SMILES for 6-amino-2,3-bis(4-methylpentoxy)naphthalene-1,4-dione is CC(C)CCCOC1=C(OCCCC(C)C)C(=O)c2cc(N)ccc2C1=O.
What is the InChIKey of 6-amino-2,3-bis(4-methylpentoxy)naphthalene-1,4-dione?
The InChIKey is VLDZRMINFDXECZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31NO4/c1-14(2)7-5-11-26-21-19(24)17-10-9-16(23)13-18(17)20(25)22(21)27-12-6-8-15(3)4/h9-10,13-15H,5-8,11-12,23H2,1-4H3.
What are the key properties of 6-amino-2,3-bis(4-methylpentoxy)naphthalene-1,4-dione?
6-amino-2,3-bis(4-methylpentoxy)naphthalene-1,4-dione has a molecular weight of 373.49 g/mol, XLogP of 4.76, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2,3-bis(4-methylpentoxy)naphthalene-1,4-dione is sourced from PubChem (CID 23038829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).