About manganese(2+);2-methylcyclopenta-1,3-diene;chloride
manganese(2+);2-methylcyclopenta-1,3-diene;chloride (PubChem CID 23039190) has the molecular formula C6H7ClMn
and a molecular weight of 169.51 g/mol. Its IUPAC name is manganese(2+);2-methylcyclopenta-1,3-diene;chloride.
Molecular Properties
| Compound Name | manganese(2+);2-methylcyclopenta-1,3-diene;chloride |
| PubChem CID | 23039190 |
| Molecular Formula | C6H7ClMn |
| Molecular Weight | 169.51 g/mol |
| Exact Mass | 168.96 |
| IUPAC Name | manganese(2+);2-methylcyclopenta-1,3-diene;chloride |
| SMILES | CC1=[C-]CC=C1.[Cl-].[Mn+2] |
| InChI | InChI=1S/C6H7.ClH.Mn/c1-6-4-2-3-5-6;;/h2,4H,3H2,1H3;1H;/q-1;;+2/p-1 |
| InChIKey | YWFKUJFDZYAEIG-UHFFFAOYSA-M |
| XLogP | -1.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.51 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze manganese(2+);2-methylcyclopenta-1,3-diene;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of manganese(2+);2-methylcyclopenta-1,3-diene;chloride?
The IUPAC name of manganese(2+);2-methylcyclopenta-1,3-diene;chloride (CID 23039190) is manganese(2+);2-methylcyclopenta-1,3-diene;chloride.
What is the SMILES notation for manganese(2+);2-methylcyclopenta-1,3-diene;chloride?
The canonical SMILES for manganese(2+);2-methylcyclopenta-1,3-diene;chloride is CC1=[C-]CC=C1.[Cl-].[Mn+2].
What is the InChIKey of manganese(2+);2-methylcyclopenta-1,3-diene;chloride?
The InChIKey is YWFKUJFDZYAEIG-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H7.ClH.Mn/c1-6-4-2-3-5-6;;/h2,4H,3H2,1H3;1H;/q-1;;+2/p-1.
What are the key properties of manganese(2+);2-methylcyclopenta-1,3-diene;chloride?
manganese(2+);2-methylcyclopenta-1,3-diene;chloride has a molecular weight of 169.51 g/mol, XLogP of -1.30, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for manganese(2+);2-methylcyclopenta-1,3-diene;chloride is sourced from PubChem (CID 23039190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).