About N-cyclohexyl-N'-(1-morpholin-2-ylethyl)methanediimine;methyl 4-methylbenzenesulfonate
N-cyclohexyl-N'-(1-morpholin-2-ylethyl)methanediimine;methyl 4-methylbenzenesulfonate (PubChem CID 23039361) has the molecular formula C21H33N3O4S
and a molecular weight of 423.58 g/mol. Its IUPAC name is N-cyclohexyl-N'-(1-morpholin-2-ylethyl)methanediimine;methyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | N-cyclohexyl-N'-(1-morpholin-2-ylethyl)methanediimine;methyl 4-methylbenzenesulfonate |
| PubChem CID | 23039361 |
| Molecular Formula | C21H33N3O4S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | N-cyclohexyl-N'-(1-morpholin-2-ylethyl)methanediimine;methyl 4-methylbenzenesulfonate |
| SMILES | CC(N=C=NC1CCCCC1)C1CNCCO1.COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H23N3O.C8H10O3S/c1-11(13-9-14-7-8-17-13)15-10-16-12-5-3-2-4-6-12;1-7-3-5-8(6-4-7)12(9,10)11-2/h11-14H,2-9H2,1H3;3-6H,1-2H3 |
| InChIKey | HTVOMPVFAGOQSH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexyl-N'-(1-morpholin-2-ylethyl)methanediimine;methyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-N'-(1-morpholin-2-ylethyl)methanediimine;methyl 4-methylbenzenesulfonate?
The IUPAC name of N-cyclohexyl-N'-(1-morpholin-2-ylethyl)methanediimine;methyl 4-methylbenzenesulfonate (CID 23039361) is N-cyclohexyl-N'-(1-morpholin-2-ylethyl)methanediimine;methyl 4-methylbenzenesulfonate.
What is the SMILES notation for N-cyclohexyl-N'-(1-morpholin-2-ylethyl)methanediimine;methyl 4-methylbenzenesulfonate?
The canonical SMILES for N-cyclohexyl-N'-(1-morpholin-2-ylethyl)methanediimine;methyl 4-methylbenzenesulfonate is CC(N=C=NC1CCCCC1)C1CNCCO1.COS(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of N-cyclohexyl-N'-(1-morpholin-2-ylethyl)methanediimine;methyl 4-methylbenzenesulfonate?
The InChIKey is HTVOMPVFAGOQSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O.C8H10O3S/c1-11(13-9-14-7-8-17-13)15-10-16-12-5-3-2-4-6-12;1-7-3-5-8(6-4-7)12(9,10)11-2/h11-14H,2-9H2,1H3;3-6H,1-2H3.
What are the key properties of N-cyclohexyl-N'-(1-morpholin-2-ylethyl)methanediimine;methyl 4-methylbenzenesulfonate?
N-cyclohexyl-N'-(1-morpholin-2-ylethyl)methanediimine;methyl 4-methylbenzenesulfonate has a molecular weight of 423.58 g/mol, XLogP of 3.20, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-N'-(1-morpholin-2-ylethyl)methanediimine;methyl 4-methylbenzenesulfonate is sourced from PubChem (CID 23039361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).