C14H16Cl3NO4 — CID 2303951
methyl N-[(2R)-5-tert-butyl-2-(trichloromethyl)-1,3-benzodioxol-2-yl]carbamate (PubChem CID 2303951) has the molecular formula C14H16Cl3NO4 and a molecular weight of 368.64 g/mol. Its IUPAC name is methyl N-[(2R)-5-tert-butyl-2-(trichloromethyl)-1,3-benzodioxol-2-yl]carbamate.
| Compound Name | methyl N-[(2R)-5-tert-butyl-2-(trichloromethyl)-1,3-benzodioxol-2-yl]carbamate |
|---|---|
| PubChem CID | 2303951 |
| Molecular Formula | C14H16Cl3NO4 |
| Molecular Weight | 368.64 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | methyl N-[(2R)-5-tert-butyl-2-(trichloromethyl)-1,3-benzodioxol-2-yl]carbamate |
| SMILES | COC(=O)N[C@]1(C(Cl)(Cl)Cl)Oc2ccc(C(C)(C)C)cc2O1 |
| InChI | InChI=1S/C14H16Cl3NO4/c1-12(2,3)8-5-6-9-10(7-8)22-14(21-9,13(15,16)17)18-11(19)20-4/h5-7H,1-4H3,(H,18,19)/t14-/m1/s1 |
| InChIKey | NMJWGUOWWHPTEL-CQSZACIVSA-N |
| XLogP | 4.14 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.64 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|