About (3-tert-butyl-2-phenyl-1,3-oxazolidin-5-yl)methyl phenylmethanesulfonate
(3-tert-butyl-2-phenyl-1,3-oxazolidin-5-yl)methyl phenylmethanesulfonate (PubChem CID 23039932) has the molecular formula C21H27NO4S
and a molecular weight of 389.52 g/mol. Its IUPAC name is (3-tert-butyl-2-phenyl-1,3-oxazolidin-5-yl)methyl phenylmethanesulfonate.
Molecular Properties
| Compound Name | (3-tert-butyl-2-phenyl-1,3-oxazolidin-5-yl)methyl phenylmethanesulfonate |
| PubChem CID | 23039932 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | (3-tert-butyl-2-phenyl-1,3-oxazolidin-5-yl)methyl phenylmethanesulfonate |
| SMILES | CC(C)(C)N1CC(COS(=O)(=O)Cc2ccccc2)OC1c1ccccc1 |
| InChI | InChI=1S/C21H27NO4S/c1-21(2,3)22-14-19(26-20(22)18-12-8-5-9-13-18)15-25-27(23,24)16-17-10-6-4-7-11-17/h4-13,19-20H,14-16H2,1-3H3 |
| InChIKey | SONOVJGELMLRKI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3-tert-butyl-2-phenyl-1,3-oxazolidin-5-yl)methyl phenylmethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-tert-butyl-2-phenyl-1,3-oxazolidin-5-yl)methyl phenylmethanesulfonate?
The IUPAC name of (3-tert-butyl-2-phenyl-1,3-oxazolidin-5-yl)methyl phenylmethanesulfonate (CID 23039932) is (3-tert-butyl-2-phenyl-1,3-oxazolidin-5-yl)methyl phenylmethanesulfonate.
What is the SMILES notation for (3-tert-butyl-2-phenyl-1,3-oxazolidin-5-yl)methyl phenylmethanesulfonate?
The canonical SMILES for (3-tert-butyl-2-phenyl-1,3-oxazolidin-5-yl)methyl phenylmethanesulfonate is CC(C)(C)N1CC(COS(=O)(=O)Cc2ccccc2)OC1c1ccccc1.
What is the InChIKey of (3-tert-butyl-2-phenyl-1,3-oxazolidin-5-yl)methyl phenylmethanesulfonate?
The InChIKey is SONOVJGELMLRKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27NO4S/c1-21(2,3)22-14-19(26-20(22)18-12-8-5-9-13-18)15-25-27(23,24)16-17-10-6-4-7-11-17/h4-13,19-20H,14-16H2,1-3H3.
What are the key properties of (3-tert-butyl-2-phenyl-1,3-oxazolidin-5-yl)methyl phenylmethanesulfonate?
(3-tert-butyl-2-phenyl-1,3-oxazolidin-5-yl)methyl phenylmethanesulfonate has a molecular weight of 389.52 g/mol, XLogP of 3.73, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-tert-butyl-2-phenyl-1,3-oxazolidin-5-yl)methyl phenylmethanesulfonate is sourced from PubChem (CID 23039932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).