C23H33N3O2 — CID 23040350
N-(4-amino-2,6-diethylphenyl)-2-butyl-1,5,6-trimethyl-4-oxopyridine-3-carboxamide (PubChem CID 23040350) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is N-(4-amino-2,6-diethylphenyl)-2-butyl-1,5,6-trimethyl-4-oxopyridine-3-carboxamide.
| Compound Name | N-(4-amino-2,6-diethylphenyl)-2-butyl-1,5,6-trimethyl-4-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 23040350 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | N-(4-amino-2,6-diethylphenyl)-2-butyl-1,5,6-trimethyl-4-oxopyridine-3-carboxamide |
| SMILES | CCCCc1c(C(=O)Nc2c(CC)cc(N)cc2CC)c(=O)c(C)c(C)n1C |
| InChI | InChI=1S/C23H33N3O2/c1-7-10-11-19-20(22(27)14(4)15(5)26(19)6)23(28)25-21-16(8-2)12-18(24)13-17(21)9-3/h12-13H,7-11,24H2,1-6H3,(H,25,28) |
| InChIKey | GHZPFONWJZGIDV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|