C26H46O7 — CID 23040980
2-[1-carboxy-2,2-dimethyl-1-(oxiran-2-yl)octoxy]-3,3-dimethyl-2-(oxiran-2-yl)nonanoic acid (PubChem CID 23040980) has the molecular formula C26H46O7 and a molecular weight of 470.65 g/mol. Its IUPAC name is 2-[1-carboxy-2,2-dimethyl-1-(oxiran-2-yl)octoxy]-3,3-dimethyl-2-(oxiran-2-yl)nonanoic acid.
| Compound Name | 2-[1-carboxy-2,2-dimethyl-1-(oxiran-2-yl)octoxy]-3,3-dimethyl-2-(oxiran-2-yl)nonanoic acid |
|---|---|
| PubChem CID | 23040980 |
| Molecular Formula | C26H46O7 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | 2-[1-carboxy-2,2-dimethyl-1-(oxiran-2-yl)octoxy]-3,3-dimethyl-2-(oxiran-2-yl)nonanoic acid |
| SMILES | CCCCCCC(C)(C)C(OC(C(=O)O)(C1CO1)C(C)(C)CCCCCC)(C(=O)O)C1CO1 |
| InChI | InChI=1S/C26H46O7/c1-7-9-11-13-15-23(3,4)25(21(27)28,19-17-31-19)33-26(22(29)30,20-18-32-20)24(5,6)16-14-12-10-8-2/h19-20H,7-18H2,1-6H3,(H,27,28)(H,29,30) |
| InChIKey | IAOGETRTQGLAIB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|