About 2-[5-(2,6-difluorophenyl)-2-oxo-1,3,4-oxadiazol-3-yl]benzonitrile
2-[5-(2,6-difluorophenyl)-2-oxo-1,3,4-oxadiazol-3-yl]benzonitrile (PubChem CID 23042028) has the molecular formula C15H7F2N3O2
and a molecular weight of 299.24 g/mol. Its IUPAC name is 2-[5-(2,6-difluorophenyl)-2-oxo-1,3,4-oxadiazol-3-yl]benzonitrile.
Molecular Properties
| Compound Name | 2-[5-(2,6-difluorophenyl)-2-oxo-1,3,4-oxadiazol-3-yl]benzonitrile |
| PubChem CID | 23042028 |
| Molecular Formula | C15H7F2N3O2 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 2-[5-(2,6-difluorophenyl)-2-oxo-1,3,4-oxadiazol-3-yl]benzonitrile |
| SMILES | N#Cc1ccccc1-n1nc(-c2c(F)cccc2F)oc1=O |
| InChI | InChI=1S/C15H7F2N3O2/c16-10-5-3-6-11(17)13(10)14-19-20(15(21)22-14)12-7-2-1-4-9(12)8-18/h1-7H |
| InChIKey | QHZHCWZBDLIYJR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 71.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[5-(2,6-difluorophenyl)-2-oxo-1,3,4-oxadiazol-3-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(2,6-difluorophenyl)-2-oxo-1,3,4-oxadiazol-3-yl]benzonitrile?
The IUPAC name of 2-[5-(2,6-difluorophenyl)-2-oxo-1,3,4-oxadiazol-3-yl]benzonitrile (CID 23042028) is 2-[5-(2,6-difluorophenyl)-2-oxo-1,3,4-oxadiazol-3-yl]benzonitrile.
What is the SMILES notation for 2-[5-(2,6-difluorophenyl)-2-oxo-1,3,4-oxadiazol-3-yl]benzonitrile?
The canonical SMILES for 2-[5-(2,6-difluorophenyl)-2-oxo-1,3,4-oxadiazol-3-yl]benzonitrile is N#Cc1ccccc1-n1nc(-c2c(F)cccc2F)oc1=O.
What is the InChIKey of 2-[5-(2,6-difluorophenyl)-2-oxo-1,3,4-oxadiazol-3-yl]benzonitrile?
The InChIKey is QHZHCWZBDLIYJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H7F2N3O2/c16-10-5-3-6-11(17)13(10)14-19-20(15(21)22-14)12-7-2-1-4-9(12)8-18/h1-7H.
What are the key properties of 2-[5-(2,6-difluorophenyl)-2-oxo-1,3,4-oxadiazol-3-yl]benzonitrile?
2-[5-(2,6-difluorophenyl)-2-oxo-1,3,4-oxadiazol-3-yl]benzonitrile has a molecular weight of 299.24 g/mol, XLogP of 2.64, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2,6-difluorophenyl)-2-oxo-1,3,4-oxadiazol-3-yl]benzonitrile is sourced from PubChem (CID 23042028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).