About 3-(3-chloro-2-pyridinyl)-5-(2,6-difluorophenyl)-1,3,4-oxadiazol-2-one
3-(3-chloro-2-pyridinyl)-5-(2,6-difluorophenyl)-1,3,4-oxadiazol-2-one (PubChem CID 23042094) has the molecular formula C13H6ClF2N3O2
and a molecular weight of 309.66 g/mol. Its IUPAC name is 3-(3-chloro-2-pyridinyl)-5-(2,6-difluorophenyl)-1,3,4-oxadiazol-2-one.
Molecular Properties
| Compound Name | 3-(3-chloro-2-pyridinyl)-5-(2,6-difluorophenyl)-1,3,4-oxadiazol-2-one |
| PubChem CID | 23042094 |
| Molecular Formula | C13H6ClF2N3O2 |
| Molecular Weight | 309.66 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | 3-(3-chloro-2-pyridinyl)-5-(2,6-difluorophenyl)-1,3,4-oxadiazol-2-one |
| SMILES | O=c1oc(-c2c(F)cccc2F)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C13H6ClF2N3O2/c14-7-3-2-6-17-11(7)19-13(20)21-12(18-19)10-8(15)4-1-5-9(10)16/h1-6H |
| InChIKey | VVAWRSGSGMNOEO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.66 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3-chloro-2-pyridinyl)-5-(2,6-difluorophenyl)-1,3,4-oxadiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chloro-2-pyridinyl)-5-(2,6-difluorophenyl)-1,3,4-oxadiazol-2-one?
The IUPAC name of 3-(3-chloro-2-pyridinyl)-5-(2,6-difluorophenyl)-1,3,4-oxadiazol-2-one (CID 23042094) is 3-(3-chloro-2-pyridinyl)-5-(2,6-difluorophenyl)-1,3,4-oxadiazol-2-one.
What is the SMILES notation for 3-(3-chloro-2-pyridinyl)-5-(2,6-difluorophenyl)-1,3,4-oxadiazol-2-one?
The canonical SMILES for 3-(3-chloro-2-pyridinyl)-5-(2,6-difluorophenyl)-1,3,4-oxadiazol-2-one is O=c1oc(-c2c(F)cccc2F)nn1-c1ncccc1Cl.
What is the InChIKey of 3-(3-chloro-2-pyridinyl)-5-(2,6-difluorophenyl)-1,3,4-oxadiazol-2-one?
The InChIKey is VVAWRSGSGMNOEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6ClF2N3O2/c14-7-3-2-6-17-11(7)19-13(20)21-12(18-19)10-8(15)4-1-5-9(10)16/h1-6H.
What are the key properties of 3-(3-chloro-2-pyridinyl)-5-(2,6-difluorophenyl)-1,3,4-oxadiazol-2-one?
3-(3-chloro-2-pyridinyl)-5-(2,6-difluorophenyl)-1,3,4-oxadiazol-2-one has a molecular weight of 309.66 g/mol, XLogP of 2.82, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chloro-2-pyridinyl)-5-(2,6-difluorophenyl)-1,3,4-oxadiazol-2-one is sourced from PubChem (CID 23042094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).