C10H13F9O — CID 23042180
1,1,1,2,3,4,5,5,5-nonafluoro-2,4-dimethyl-3-propoxypentane (PubChem CID 23042180) has the molecular formula C10H13F9O and a molecular weight of 320.20 g/mol. Its IUPAC name is 1,1,1,2,3,4,5,5,5-nonafluoro-2,4-dimethyl-3-propoxypentane.
| Compound Name | 1,1,1,2,3,4,5,5,5-nonafluoro-2,4-dimethyl-3-propoxypentane |
|---|---|
| PubChem CID | 23042180 |
| Molecular Formula | C10H13F9O |
| Molecular Weight | 320.20 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 1,1,1,2,3,4,5,5,5-nonafluoro-2,4-dimethyl-3-propoxypentane |
| SMILES | CCCOC(F)(C(C)(F)C(F)(F)F)C(C)(F)C(F)(F)F |
| InChI | InChI=1S/C10H13F9O/c1-4-5-20-8(13,6(2,11)9(14,15)16)7(3,12)10(17,18)19/h4-5H2,1-3H3 |
| InChIKey | UJLYMLDVOZGFGN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.20 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |