About 3-fluoro-3-propan-2-yl-2,4-bis(trifluoromethyl)penta-1,4-diene
3-fluoro-3-propan-2-yl-2,4-bis(trifluoromethyl)penta-1,4-diene (PubChem CID 23042181) has the molecular formula C10H11F7
and a molecular weight of 264.18 g/mol. Its IUPAC name is 3-fluoro-3-propan-2-yl-2,4-bis(trifluoromethyl)penta-1,4-diene.
Molecular Properties
| Compound Name | 3-fluoro-3-propan-2-yl-2,4-bis(trifluoromethyl)penta-1,4-diene |
| PubChem CID | 23042181 |
| Molecular Formula | C10H11F7 |
| Molecular Weight | 264.18 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 3-fluoro-3-propan-2-yl-2,4-bis(trifluoromethyl)penta-1,4-diene |
| SMILES | C=C(C(F)(F)F)C(F)(C(=C)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C10H11F7/c1-5(2)8(11,6(3)9(12,13)14)7(4)10(15,16)17/h5H,3-4H2,1-2H3 |
| InChIKey | PVUZOBGYVPGNNH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.18 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-3-propan-2-yl-2,4-bis(trifluoromethyl)penta-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-3-propan-2-yl-2,4-bis(trifluoromethyl)penta-1,4-diene?
The IUPAC name of 3-fluoro-3-propan-2-yl-2,4-bis(trifluoromethyl)penta-1,4-diene (CID 23042181) is 3-fluoro-3-propan-2-yl-2,4-bis(trifluoromethyl)penta-1,4-diene.
What is the SMILES notation for 3-fluoro-3-propan-2-yl-2,4-bis(trifluoromethyl)penta-1,4-diene?
The canonical SMILES for 3-fluoro-3-propan-2-yl-2,4-bis(trifluoromethyl)penta-1,4-diene is C=C(C(F)(F)F)C(F)(C(=C)C(F)(F)F)C(C)C.
What is the InChIKey of 3-fluoro-3-propan-2-yl-2,4-bis(trifluoromethyl)penta-1,4-diene?
The InChIKey is PVUZOBGYVPGNNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F7/c1-5(2)8(11,6(3)9(12,13)14)7(4)10(15,16)17/h5H,3-4H2,1-2H3.
What are the key properties of 3-fluoro-3-propan-2-yl-2,4-bis(trifluoromethyl)penta-1,4-diene?
3-fluoro-3-propan-2-yl-2,4-bis(trifluoromethyl)penta-1,4-diene has a molecular weight of 264.18 g/mol, XLogP of 4.59, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-3-propan-2-yl-2,4-bis(trifluoromethyl)penta-1,4-diene is sourced from PubChem (CID 23042181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).