C9H8Cl3NO2S — CID 23042337
4-(trichloromethylsulfanyl)-3a,4,5,7a-tetrahydroisoindole-1,3-dione (PubChem CID 23042337) has the molecular formula C9H8Cl3NO2S and a molecular weight of 300.59 g/mol. Its IUPAC name is 4-(trichloromethylsulfanyl)-3a,4,5,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 4-(trichloromethylsulfanyl)-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 23042337 |
| Molecular Formula | C9H8Cl3NO2S |
| Molecular Weight | 300.59 g/mol |
| Exact Mass | 298.93 |
| IUPAC Name | 4-(trichloromethylsulfanyl)-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1NC(=O)C2C(SC(Cl)(Cl)Cl)CC=CC12 |
| InChI | InChI=1S/C9H8Cl3NO2S/c10-9(11,12)16-5-3-1-2-4-6(5)8(15)13-7(4)14/h1-2,4-6H,3H2,(H,13,14,15) |
| InChIKey | HCXQEJUHWRQEAL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.59 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|