About 2-amino-4-methylpentanoic acid;1H-pyrimidine-2,4-dione
2-amino-4-methylpentanoic acid;1H-pyrimidine-2,4-dione (PubChem CID 23042821) has the molecular formula C10H17N3O4
and a molecular weight of 243.26 g/mol. Its IUPAC name is 2-amino-4-methylpentanoic acid;1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 2-amino-4-methylpentanoic acid;1H-pyrimidine-2,4-dione |
| PubChem CID | 23042821 |
| Molecular Formula | C10H17N3O4 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 2-amino-4-methylpentanoic acid;1H-pyrimidine-2,4-dione |
| SMILES | CC(C)CC(N)C(=O)O.O=c1cc[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C6H13NO2.C4H4N2O2/c1-4(2)3-5(7)6(8)9;7-3-1-2-5-4(8)6-3/h4-5H,3,7H2,1-2H3,(H,8,9);1-2H,(H2,5,6,7,8) |
| InChIKey | KSZLSAKOKXNFSA-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 129.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-4-methylpentanoic acid;1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-methylpentanoic acid;1H-pyrimidine-2,4-dione?
The IUPAC name of 2-amino-4-methylpentanoic acid;1H-pyrimidine-2,4-dione (CID 23042821) is 2-amino-4-methylpentanoic acid;1H-pyrimidine-2,4-dione.
What is the SMILES notation for 2-amino-4-methylpentanoic acid;1H-pyrimidine-2,4-dione?
The canonical SMILES for 2-amino-4-methylpentanoic acid;1H-pyrimidine-2,4-dione is CC(C)CC(N)C(=O)O.O=c1cc[nH]c(=O)[nH]1.
What is the InChIKey of 2-amino-4-methylpentanoic acid;1H-pyrimidine-2,4-dione?
The InChIKey is KSZLSAKOKXNFSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2.C4H4N2O2/c1-4(2)3-5(7)6(8)9;7-3-1-2-5-4(8)6-3/h4-5H,3,7H2,1-2H3,(H,8,9);1-2H,(H2,5,6,7,8).
What are the key properties of 2-amino-4-methylpentanoic acid;1H-pyrimidine-2,4-dione?
2-amino-4-methylpentanoic acid;1H-pyrimidine-2,4-dione has a molecular weight of 243.26 g/mol, XLogP of -0.49, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-methylpentanoic acid;1H-pyrimidine-2,4-dione is sourced from PubChem (CID 23042821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).