About N-(4-fluorophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide
N-(4-fluorophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide (PubChem CID 2304303) has the molecular formula C12H11FN2O2
and a molecular weight of 234.23 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(4-fluorophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide |
| PubChem CID | 2304303 |
| Molecular Formula | C12H11FN2O2 |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | N-(4-fluorophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1noc(C)c1C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C12H11FN2O2/c1-7-11(8(2)17-15-7)12(16)14-10-5-3-9(13)4-6-10/h3-6H,1-2H3,(H,14,16) |
| InChIKey | XMFGYLAMMVOART-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-fluorophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-fluorophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide?
The IUPAC name of N-(4-fluorophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide (CID 2304303) is N-(4-fluorophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide.
What is the SMILES notation for N-(4-fluorophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide?
The canonical SMILES for N-(4-fluorophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide is Cc1noc(C)c1C(=O)Nc1ccc(F)cc1.
What is the InChIKey of N-(4-fluorophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide?
The InChIKey is XMFGYLAMMVOART-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11FN2O2/c1-7-11(8(2)17-15-7)12(16)14-10-5-3-9(13)4-6-10/h3-6H,1-2H3,(H,14,16).
What are the key properties of N-(4-fluorophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide?
N-(4-fluorophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide has a molecular weight of 234.23 g/mol, XLogP of 2.68, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-fluorophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide is sourced from PubChem (CID 2304303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).