About 4-methoxy-6-methyl-N-(1,2,4-triazol-1-ylmethyl)pyrimidin-2-amine
4-methoxy-6-methyl-N-(1,2,4-triazol-1-ylmethyl)pyrimidin-2-amine (PubChem CID 23043232) has the molecular formula C9H12N6O
and a molecular weight of 220.24 g/mol. Its IUPAC name is 4-methoxy-6-methyl-N-(1,2,4-triazol-1-ylmethyl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-methoxy-6-methyl-N-(1,2,4-triazol-1-ylmethyl)pyrimidin-2-amine |
| PubChem CID | 23043232 |
| Molecular Formula | C9H12N6O |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 4-methoxy-6-methyl-N-(1,2,4-triazol-1-ylmethyl)pyrimidin-2-amine |
| SMILES | COc1cc(C)nc(NCn2cncn2)n1 |
| InChI | InChI=1S/C9H12N6O/c1-7-3-8(16-2)14-9(13-7)11-6-15-5-10-4-12-15/h3-5H,6H2,1-2H3,(H,11,13,14) |
| InChIKey | GFTWBCLNHFEUOW-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-methoxy-6-methyl-N-(1,2,4-triazol-1-ylmethyl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-6-methyl-N-(1,2,4-triazol-1-ylmethyl)pyrimidin-2-amine?
The IUPAC name of 4-methoxy-6-methyl-N-(1,2,4-triazol-1-ylmethyl)pyrimidin-2-amine (CID 23043232) is 4-methoxy-6-methyl-N-(1,2,4-triazol-1-ylmethyl)pyrimidin-2-amine.
What is the SMILES notation for 4-methoxy-6-methyl-N-(1,2,4-triazol-1-ylmethyl)pyrimidin-2-amine?
The canonical SMILES for 4-methoxy-6-methyl-N-(1,2,4-triazol-1-ylmethyl)pyrimidin-2-amine is COc1cc(C)nc(NCn2cncn2)n1.
What is the InChIKey of 4-methoxy-6-methyl-N-(1,2,4-triazol-1-ylmethyl)pyrimidin-2-amine?
The InChIKey is GFTWBCLNHFEUOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N6O/c1-7-3-8(16-2)14-9(13-7)11-6-15-5-10-4-12-15/h3-5H,6H2,1-2H3,(H,11,13,14).
What are the key properties of 4-methoxy-6-methyl-N-(1,2,4-triazol-1-ylmethyl)pyrimidin-2-amine?
4-methoxy-6-methyl-N-(1,2,4-triazol-1-ylmethyl)pyrimidin-2-amine has a molecular weight of 220.24 g/mol, XLogP of 0.45, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-6-methyl-N-(1,2,4-triazol-1-ylmethyl)pyrimidin-2-amine is sourced from PubChem (CID 23043232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).