About 2-tert-butylbenzene-1,3-dicarboperoxoic acid
2-tert-butylbenzene-1,3-dicarboperoxoic acid (PubChem CID 23043490) has the molecular formula C12H14O6
and a molecular weight of 254.24 g/mol. Its IUPAC name is 2-tert-butylbenzene-1,3-dicarboperoxoic acid.
Molecular Properties
| Compound Name | 2-tert-butylbenzene-1,3-dicarboperoxoic acid |
| PubChem CID | 23043490 |
| Molecular Formula | C12H14O6 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 2-tert-butylbenzene-1,3-dicarboperoxoic acid |
| SMILES | CC(C)(C)c1c(C(=O)OO)cccc1C(=O)OO |
| InChI | InChI=1S/C12H14O6/c1-12(2,3)9-7(10(13)17-15)5-4-6-8(9)11(14)18-16/h4-6,15-16H,1-3H3 |
| InChIKey | DKDXLROXOQXMDZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butylbenzene-1,3-dicarboperoxoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butylbenzene-1,3-dicarboperoxoic acid?
The IUPAC name of 2-tert-butylbenzene-1,3-dicarboperoxoic acid (CID 23043490) is 2-tert-butylbenzene-1,3-dicarboperoxoic acid.
What is the SMILES notation for 2-tert-butylbenzene-1,3-dicarboperoxoic acid?
The canonical SMILES for 2-tert-butylbenzene-1,3-dicarboperoxoic acid is CC(C)(C)c1c(C(=O)OO)cccc1C(=O)OO.
What is the InChIKey of 2-tert-butylbenzene-1,3-dicarboperoxoic acid?
The InChIKey is DKDXLROXOQXMDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O6/c1-12(2,3)9-7(10(13)17-15)5-4-6-8(9)11(14)18-16/h4-6,15-16H,1-3H3.
What are the key properties of 2-tert-butylbenzene-1,3-dicarboperoxoic acid?
2-tert-butylbenzene-1,3-dicarboperoxoic acid has a molecular weight of 254.24 g/mol, XLogP of 2.24, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butylbenzene-1,3-dicarboperoxoic acid is sourced from PubChem (CID 23043490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).