C9H3F6NS — CID 23043720
5,7-bis(trifluoromethyl)-1,3-benzothiazole (PubChem CID 23043720) has the molecular formula C9H3F6NS and a molecular weight of 271.19 g/mol. Its IUPAC name is 5,7-bis(trifluoromethyl)-1,3-benzothiazole.
| Compound Name | 5,7-bis(trifluoromethyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 23043720 |
| Molecular Formula | C9H3F6NS |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | 5,7-bis(trifluoromethyl)-1,3-benzothiazole |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)c2scnc2c1 |
| InChI | InChI=1S/C9H3F6NS/c10-8(11,12)4-1-5(9(13,14)15)7-6(2-4)16-3-17-7/h1-3H |
| InChIKey | MUTVNEZNCPSMIG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |