C22H31ClN2O — CID 23043751
3-[(E)-[3-[1-(4-chlorophenyl)ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]amino]oxy-N,N,2-trimethylpropan-1-amine (PubChem CID 23043751) has the molecular formula C22H31ClN2O and a molecular weight of 374.96 g/mol. Its IUPAC name is 3-[(E)-[3-[1-(4-chlorophenyl)ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]amino]oxy-N,N,2-trimethylpropan-1-amine.
| Compound Name | 3-[(E)-[3-[1-(4-chlorophenyl)ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]amino]oxy-N,N,2-trimethylpropan-1-amine |
|---|---|
| PubChem CID | 23043751 |
| Molecular Formula | C22H31ClN2O |
| Molecular Weight | 374.96 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 3-[(E)-[3-[1-(4-chlorophenyl)ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]amino]oxy-N,N,2-trimethylpropan-1-amine |
| SMILES | C=C(C1=C/C(=N/OCC(C)CN(C)C)CC(C)(C)C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H31ClN2O/c1-16(14-25(5)6)15-26-24-21-11-19(12-22(3,4)13-21)17(2)18-7-9-20(23)10-8-18/h7-11,16H,2,12-15H2,1,3-6H3/b24-21- |
| InChIKey | MFVGFTQIXBDYKS-FLFQWRMESA-N |
| XLogP | 5.67 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.96 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|