C21H28Cl2N2O — CID 23043772
3-[(E)-[3-[1-(2,6-dichlorophenyl)ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]amino]oxy-N,N-dimethylpropan-1-amine (PubChem CID 23043772) has the molecular formula C21H28Cl2N2O and a molecular weight of 395.37 g/mol. Its IUPAC name is 3-[(E)-[3-[1-(2,6-dichlorophenyl)ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]amino]oxy-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[(E)-[3-[1-(2,6-dichlorophenyl)ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]amino]oxy-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 23043772 |
| Molecular Formula | C21H28Cl2N2O |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 3-[(E)-[3-[1-(2,6-dichlorophenyl)ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]amino]oxy-N,N-dimethylpropan-1-amine |
| SMILES | C=C(C1=C/C(=N/OCCCN(C)C)CC(C)(C)C1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C21H28Cl2N2O/c1-15(20-18(22)8-6-9-19(20)23)16-12-17(14-21(2,3)13-16)24-26-11-7-10-25(4)5/h6,8-9,12H,1,7,10-11,13-14H2,2-5H3/b24-17- |
| InChIKey | XLHXYWCRALHNOE-ULJHMMPZSA-N |
| XLogP | 6.08 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|