C21H29ClN2O — CID 23043774
3-[(E)-[3-[1-(3-chlorophenyl)ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]amino]oxy-N,N-dimethylpropan-1-amine (PubChem CID 23043774) has the molecular formula C21H29ClN2O and a molecular weight of 360.93 g/mol. Its IUPAC name is 3-[(E)-[3-[1-(3-chlorophenyl)ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]amino]oxy-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[(E)-[3-[1-(3-chlorophenyl)ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]amino]oxy-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 23043774 |
| Molecular Formula | C21H29ClN2O |
| Molecular Weight | 360.93 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 3-[(E)-[3-[1-(3-chlorophenyl)ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]amino]oxy-N,N-dimethylpropan-1-amine |
| SMILES | C=C(C1=C/C(=N/OCCCN(C)C)CC(C)(C)C1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H29ClN2O/c1-16(17-8-6-9-19(22)12-17)18-13-20(15-21(2,3)14-18)23-25-11-7-10-24(4)5/h6,8-9,12-13H,1,7,10-11,14-15H2,2-5H3/b23-20- |
| InChIKey | IUPRXELDNBQTKW-ATJXCDBQSA-N |
| XLogP | 5.42 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.93 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|