C10H16N2O2 — CID 23044136
7,7,8,8-tetramethyl-1,2-diazabicyclo[4.2.0]octane-3,5-dione (PubChem CID 23044136) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 7,7,8,8-tetramethyl-1,2-diazabicyclo[4.2.0]octane-3,5-dione.
| Compound Name | 7,7,8,8-tetramethyl-1,2-diazabicyclo[4.2.0]octane-3,5-dione |
|---|---|
| PubChem CID | 23044136 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 7,7,8,8-tetramethyl-1,2-diazabicyclo[4.2.0]octane-3,5-dione |
| SMILES | CC1(C)C2C(=O)CC(=O)NN2C1(C)C |
| InChI | InChI=1S/C10H16N2O2/c1-9(2)8-6(13)5-7(14)11-12(8)10(9,3)4/h8H,5H2,1-4H3,(H,11,14) |
| InChIKey | DTFFDANKLWLBQR-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|