C12H20N2O2 — CID 23044137
2,4,7,7,8,8-hexamethyl-2,4-diazabicyclo[4.2.0]octane-3,5-dione (PubChem CID 23044137) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2,4,7,7,8,8-hexamethyl-2,4-diazabicyclo[4.2.0]octane-3,5-dione.
| Compound Name | 2,4,7,7,8,8-hexamethyl-2,4-diazabicyclo[4.2.0]octane-3,5-dione |
|---|---|
| PubChem CID | 23044137 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 2,4,7,7,8,8-hexamethyl-2,4-diazabicyclo[4.2.0]octane-3,5-dione |
| SMILES | CN1C(=O)C2C(N(C)C1=O)C(C)(C)C2(C)C |
| InChI | InChI=1S/C12H20N2O2/c1-11(2)7-8(12(11,3)4)13(5)10(16)14(6)9(7)15/h7-8H,1-6H3 |
| InChIKey | JUIGPBHIRNPVIW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |