C18H18ClN3O — CID 23044294
N-(2,6-dimethylphenyl)-4-imidazol-1-ylbenzamide;hydrochloride (PubChem CID 23044294) has the molecular formula C18H18ClN3O and a molecular weight of 327.82 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-4-imidazol-1-ylbenzamide;hydrochloride.
| Compound Name | N-(2,6-dimethylphenyl)-4-imidazol-1-ylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 23044294 |
| Molecular Formula | C18H18ClN3O |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | N-(2,6-dimethylphenyl)-4-imidazol-1-ylbenzamide;hydrochloride |
| SMILES | Cc1cccc(C)c1NC(=O)c1ccc(-n2ccnc2)cc1.Cl |
| InChI | InChI=1S/C18H17N3O.ClH/c1-13-4-3-5-14(2)17(13)20-18(22)15-6-8-16(9-7-15)21-11-10-19-12-21;/h3-12H,1-2H3,(H,20,22);1H |
| InChIKey | TXYCDYUDRPIREE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |