About 6-(2-hydroxyphenyl)-1-oxa-6-azaspiro[4.4]nonane-2,7-dione
6-(2-hydroxyphenyl)-1-oxa-6-azaspiro[4.4]nonane-2,7-dione (PubChem CID 23044514) has the molecular formula C13H13NO4
and a molecular weight of 247.25 g/mol. Its IUPAC name is 6-(2-hydroxyphenyl)-1-oxa-6-azaspiro[4.4]nonane-2,7-dione.
Molecular Properties
| Compound Name | 6-(2-hydroxyphenyl)-1-oxa-6-azaspiro[4.4]nonane-2,7-dione |
| PubChem CID | 23044514 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 6-(2-hydroxyphenyl)-1-oxa-6-azaspiro[4.4]nonane-2,7-dione |
| SMILES | O=C1CCC2(CCC(=O)N2c2ccccc2O)O1 |
| InChI | InChI=1S/C13H13NO4/c15-10-4-2-1-3-9(10)14-11(16)5-7-13(14)8-6-12(17)18-13/h1-4,15H,5-8H2 |
| InChIKey | JGYCNAKOHNINPW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(2-hydroxyphenyl)-1-oxa-6-azaspiro[4.4]nonane-2,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-hydroxyphenyl)-1-oxa-6-azaspiro[4.4]nonane-2,7-dione?
The IUPAC name of 6-(2-hydroxyphenyl)-1-oxa-6-azaspiro[4.4]nonane-2,7-dione (CID 23044514) is 6-(2-hydroxyphenyl)-1-oxa-6-azaspiro[4.4]nonane-2,7-dione.
What is the SMILES notation for 6-(2-hydroxyphenyl)-1-oxa-6-azaspiro[4.4]nonane-2,7-dione?
The canonical SMILES for 6-(2-hydroxyphenyl)-1-oxa-6-azaspiro[4.4]nonane-2,7-dione is O=C1CCC2(CCC(=O)N2c2ccccc2O)O1.
What is the InChIKey of 6-(2-hydroxyphenyl)-1-oxa-6-azaspiro[4.4]nonane-2,7-dione?
The InChIKey is JGYCNAKOHNINPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO4/c15-10-4-2-1-3-9(10)14-11(16)5-7-13(14)8-6-12(17)18-13/h1-4,15H,5-8H2.
What are the key properties of 6-(2-hydroxyphenyl)-1-oxa-6-azaspiro[4.4]nonane-2,7-dione?
6-(2-hydroxyphenyl)-1-oxa-6-azaspiro[4.4]nonane-2,7-dione has a molecular weight of 247.25 g/mol, XLogP of 1.55, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-hydroxyphenyl)-1-oxa-6-azaspiro[4.4]nonane-2,7-dione is sourced from PubChem (CID 23044514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).