C26H23BrN2O2 — CID 23044785
N-anthracen-9-yl-3-bromo-4-methyl-2-oxo-7,8,9,10-tetrahydro-6H-pyrido[1,2-a]azepine-1-carboxamide (PubChem CID 23044785) has the molecular formula C26H23BrN2O2 and a molecular weight of 475.39 g/mol. Its IUPAC name is N-anthracen-9-yl-3-bromo-4-methyl-2-oxo-7,8,9,10-tetrahydro-6H-pyrido[1,2-a]azepine-1-carboxamide.
| Compound Name | N-anthracen-9-yl-3-bromo-4-methyl-2-oxo-7,8,9,10-tetrahydro-6H-pyrido[1,2-a]azepine-1-carboxamide |
|---|---|
| PubChem CID | 23044785 |
| Molecular Formula | C26H23BrN2O2 |
| Molecular Weight | 475.39 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | N-anthracen-9-yl-3-bromo-4-methyl-2-oxo-7,8,9,10-tetrahydro-6H-pyrido[1,2-a]azepine-1-carboxamide |
| SMILES | Cc1c(Br)c(=O)c(C(=O)Nc2c3ccccc3cc3ccccc23)c2n1CCCCC2 |
| InChI | InChI=1S/C26H23BrN2O2/c1-16-23(27)25(30)22(21-13-3-2-8-14-29(16)21)26(31)28-24-19-11-6-4-9-17(19)15-18-10-5-7-12-20(18)24/h4-7,9-12,15H,2-3,8,13-14H2,1H3,(H,28,31) |
| InChIKey | PUVBMJFQNOCXFL-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.39 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|