C12H21NO — CID 23044860
N-(2-cyclohexylethyl)-2-methylprop-2-enamide (PubChem CID 23044860) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is N-(2-cyclohexylethyl)-2-methylprop-2-enamide.
| Compound Name | N-(2-cyclohexylethyl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 23044860 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | N-(2-cyclohexylethyl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCC1CCCCC1 |
| InChI | InChI=1S/C12H21NO/c1-10(2)12(14)13-9-8-11-6-4-3-5-7-11/h11H,1,3-9H2,2H3,(H,13,14) |
| InChIKey | REDFMYGTFWTKEO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|