C18H20ClN3S — CID 23045
N-[(8-chlorobenzo[b][1,4]benzothiazepin-6-yl)methyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 23045) has the molecular formula C18H20ClN3S and a molecular weight of 345.90 g/mol. Its IUPAC name is N-[(8-chlorobenzo[b][1,4]benzothiazepin-6-yl)methyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[(8-chlorobenzo[b][1,4]benzothiazepin-6-yl)methyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 23045 |
| Molecular Formula | C18H20ClN3S |
| Molecular Weight | 345.90 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-[(8-chlorobenzo[b][1,4]benzothiazepin-6-yl)methyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNCC1=Nc2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C18H20ClN3S/c1-22(2)10-9-20-12-16-14-11-13(19)7-8-17(14)23-18-6-4-3-5-15(18)21-16/h3-8,11,20H,9-10,12H2,1-2H3 |
| InChIKey | LGFFMPBXQOPBMN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.90 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|