C18H25NO3S — CID 2304513
N-[[(1R,3R,6S,7R)-6,7-dimethyl-4-oxatricyclo[4.3.0.03,7]nonan-3-yl]methyl]-4-methylbenzenesulfonamide (PubChem CID 2304513) has the molecular formula C18H25NO3S and a molecular weight of 335.47 g/mol. Its IUPAC name is N-[[(1R,3R,6S,7R)-6,7-dimethyl-4-oxatricyclo[4.3.0.03,7]nonan-3-yl]methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[[(1R,3R,6S,7R)-6,7-dimethyl-4-oxatricyclo[4.3.0.03,7]nonan-3-yl]methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 2304513 |
| Molecular Formula | C18H25NO3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | N-[[(1R,3R,6S,7R)-6,7-dimethyl-4-oxatricyclo[4.3.0.03,7]nonan-3-yl]methyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC[C@@]23C[C@H]4CC[C@]2(C)[C@@]4(C)CO3)cc1 |
| InChI | InChI=1S/C18H25NO3S/c1-13-4-6-15(7-5-13)23(20,21)19-11-18-10-14-8-9-17(18,3)16(14,2)12-22-18/h4-7,14,19H,8-12H2,1-3H3/t14-,16+,17-,18+/m1/s1 |
| InChIKey | SWZZJRJJFYIDFX-SPUZQDLCSA-N |
| XLogP | 2.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |